![7-hydroxy-2,3,4,5-tetrahydro-[1]benzofuro[2,3-c]azepin-1-one (CAS: 521937-07-5) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0700323.png "7-hydroxy-2,3,4,5-tetrahydro-[1]benzofuro[2,3-c]azepin-1-one chemical structure")
7-hydroxy-2,3,4,5-tetrahydro-[1]benzofuro[2,3-c]azepin-1-one
Catalog No: FT-0700323
CAS No: 521937-07-5
- Chemical Name: 7-hydroxy-2,3,4,5-tetrahydro-[1]benzofuro[2,3-c]azepin-1-one
- Molecular Formula: C12H11NO3
- Molecular Weight: 217.22
- InChI Key: AACFPJSJOWQNBN-UHFFFAOYSA-N
- InChI: InChI=1S/C12H11NO3/c14-7-3-4-10-9(6-7)8-2-1-5-13-12(15)11(8)16-10/h3-4,6,14H,1-2,5H2,(H,13,15)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 521937-07-5 |
|---|---|
| MF: | C12H11NO3 |
| Density: | 1.3±0.1 g/cm3 |
| Flash_Point: | 275.4±26.8 °C |
| Melting_Point: | N/A |
| Product_Name: | CID755673 |
| Symbol: | GHS07 |
| Bolling_Point: | 531.8±38.0 °C at 760 mmHg |
| FW: | 217.221 |
| Bolling_Point: | 531.8±38.0 °C at 760 mmHg |
|---|---|
| Density: | 1.3±0.1 g/cm3 |
| MF: | C12H11NO3 |
| LogP: | 1.41 |
| Exact_Mass: | 217.073898 |
| Vapor_Pressure: | 0.0±1.5 mmHg at 25°C |
| Flash_Point: | 275.4±26.8 °C |
| FW: | 217.221 |
| Refractive_Index: | 1.643 |
| PSA: | 62.47000 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302-H319 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P305 + P351 + P338 |
![(5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-one (CAS: 138629-44-4) - Related Chemical Product](/static/img/prod_pic/FT-0701068.png "(5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-one chemical structure")
